C26H19ClN2O2S3 — CID 4757406
5-benzylidene-3-[4-(2-chlorophenothiazin-10-yl)-4-oxobutyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4757406) has the molecular formula C26H19ClN2O2S3 and a molecular weight of 523.10 g/mol. Its IUPAC name is 5-benzylidene-3-[4-(2-chlorophenothiazin-10-yl)-4-oxobutyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-benzylidene-3-[4-(2-chlorophenothiazin-10-yl)-4-oxobutyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4757406 |
| Molecular Formula | C26H19ClN2O2S3 |
| Molecular Weight | 523.10 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | 5-benzylidene-3-[4-(2-chlorophenothiazin-10-yl)-4-oxobutyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccccc2)SC(=S)N1CCCC(=O)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C26H19ClN2O2S3/c27-18-12-13-22-20(16-18)29(19-9-4-5-10-21(19)33-22)24(30)11-6-14-28-25(31)23(34-26(28)32)15-17-7-2-1-3-8-17/h1-5,7-10,12-13,15-16H,6,11,14H2 |
| InChIKey | BZIZRZYOZPVRTR-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.10 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|