C24H15ClN2O3S2 — CID 2270544
(5Z)-5-benzylidene-3-[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 2270544) has the molecular formula C24H15ClN2O3S2 and a molecular weight of 478.98 g/mol. Its IUPAC name is (5Z)-5-benzylidene-3-[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-benzylidene-3-[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2270544 |
| Molecular Formula | C24H15ClN2O3S2 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | (5Z)-5-benzylidene-3-[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccccc2)C(=O)N1CC(=O)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C24H15ClN2O3S2/c25-16-10-11-20-18(13-16)27(17-8-4-5-9-19(17)31-20)22(28)14-26-23(29)21(32-24(26)30)12-15-6-2-1-3-7-15/h1-13H,14H2/b21-12- |
| InChIKey | CDCZTBOEBHFNHN-MTJSOVHGSA-N |
| XLogP | 6.21 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|