C24H15ClN2O2S3 — CID 4306293
5-benzylidene-3-[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4306293) has the molecular formula C24H15ClN2O2S3 and a molecular weight of 495.05 g/mol. Its IUPAC name is 5-benzylidene-3-[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-benzylidene-3-[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4306293 |
| Molecular Formula | C24H15ClN2O2S3 |
| Molecular Weight | 495.05 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | 5-benzylidene-3-[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccccc2)SC(=S)N1CC(=O)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C24H15ClN2O2S3/c25-16-10-11-20-18(13-16)27(17-8-4-5-9-19(17)31-20)22(28)14-26-23(29)21(32-24(26)30)12-15-6-2-1-3-7-15/h1-13H,14H2 |
| InChIKey | KXPAECSIIGGSTJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.05 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|