C16H15F3N2O4PS3+ — CID 88996528
[(5E)-5-[(2Z)-2-[3-ethyl-5-(trifluoromethyl)-1,3-benzothiazol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl-trihydroxyphosphanium (PubChem CID 88996528) has the molecular formula C16H15F3N2O4PS3+ and a molecular weight of 483.48 g/mol. Its IUPAC name is [(5E)-5-[(2Z)-2-[3-ethyl-5-(trifluoromethyl)-1,3-benzothiazol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl-trihydroxyphosphanium.
| Compound Name | [(5E)-5-[(2Z)-2-[3-ethyl-5-(trifluoromethyl)-1,3-benzothiazol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl-trihydroxyphosphanium |
|---|---|
| PubChem CID | 88996528 |
| Molecular Formula | C16H15F3N2O4PS3+ |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | [(5E)-5-[(2Z)-2-[3-ethyl-5-(trifluoromethyl)-1,3-benzothiazol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl-trihydroxyphosphanium |
| SMILES | CCN1/C(=C/C=C2/SC(=S)N(C[P+](O)(O)O)C2=O)Sc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C16H15F3N2O4PS3/c1-2-20-10-7-9(16(17,18)19)3-4-11(10)28-13(20)6-5-12-14(22)21(15(27)29-12)8-26(23,24)25/h3-7,23-25H,2,8H2,1H3/q+1/b12-5+,13-6- |
| InChIKey | YCKRSGVFPPPJJU-GFZODGFISA-N |
| XLogP | 3.92 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|