C15H13IN2OS3 — CID 149469123
(5Z)-5-[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-(iodomethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 149469123) has the molecular formula C15H13IN2OS3 and a molecular weight of 460.39 g/mol. Its IUPAC name is (5Z)-5-[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-(iodomethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-(iodomethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 149469123 |
| Molecular Formula | C15H13IN2OS3 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.92 |
| IUPAC Name | (5Z)-5-[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-3-(iodomethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1/C(=C/C=C2\SC(=S)N(CI)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C15H13IN2OS3/c1-2-17-10-5-3-4-6-11(10)21-13(17)8-7-12-14(19)18(9-16)15(20)22-12/h3-8H,2,9H2,1H3/b12-7-,13-8- |
| InChIKey | ZAZYSVRDPVTQHA-AJDRMPRJSA-N |
| XLogP | 4.60 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|