C23H19N3OS4 — CID 3531149
5-[2-[6-(1,3-benzothiazol-2-yl)-3-ethyl-1,3-benzothiazol-2-ylidene]ethylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3531149) has the molecular formula C23H19N3OS4 and a molecular weight of 481.69 g/mol. Its IUPAC name is 5-[2-[6-(1,3-benzothiazol-2-yl)-3-ethyl-1,3-benzothiazol-2-ylidene]ethylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[2-[6-(1,3-benzothiazol-2-yl)-3-ethyl-1,3-benzothiazol-2-ylidene]ethylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3531149 |
| Molecular Formula | C23H19N3OS4 |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 5-[2-[6-(1,3-benzothiazol-2-yl)-3-ethyl-1,3-benzothiazol-2-ylidene]ethylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(=CC=C2Sc3cc(-c4nc5ccccc5s4)ccc3N2CC)SC1=S |
| InChI | InChI=1S/C23H19N3OS4/c1-3-25-16-10-9-14(21-24-15-7-5-6-8-17(15)30-21)13-19(16)29-20(25)12-11-18-22(27)26(4-2)23(28)31-18/h5-13H,3-4H2,1-2H3 |
| InChIKey | NYQPDUXNDCAHSO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|