C24H20N4OS3 — CID 4674716
5-[[3-(1,3-benzothiazol-2-yl)-1-phenylpyrazol-4-yl]methylidene]-3-butyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4674716) has the molecular formula C24H20N4OS3 and a molecular weight of 476.65 g/mol. Its IUPAC name is 5-[[3-(1,3-benzothiazol-2-yl)-1-phenylpyrazol-4-yl]methylidene]-3-butyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-(1,3-benzothiazol-2-yl)-1-phenylpyrazol-4-yl]methylidene]-3-butyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4674716 |
| Molecular Formula | C24H20N4OS3 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 5-[[3-(1,3-benzothiazol-2-yl)-1-phenylpyrazol-4-yl]methylidene]-3-butyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2nc3ccccc3s2)SC1=S |
| InChI | InChI=1S/C24H20N4OS3/c1-2-3-13-27-23(29)20(32-24(27)30)14-16-15-28(17-9-5-4-6-10-17)26-21(16)22-25-18-11-7-8-12-19(18)31-22/h4-12,14-15H,2-3,13H2,1H3 |
| InChIKey | OSTKPUZHAJNQJX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|