C25H16N4O2S3 — CID 6012685
(5Z)-5-[[3-(1,3-benzothiazol-2-yl)-1-phenylpyrazol-4-yl]methylidene]-3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6012685) has the molecular formula C25H16N4O2S3 and a molecular weight of 500.63 g/mol. Its IUPAC name is (5Z)-5-[[3-(1,3-benzothiazol-2-yl)-1-phenylpyrazol-4-yl]methylidene]-3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-(1,3-benzothiazol-2-yl)-1-phenylpyrazol-4-yl]methylidene]-3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6012685 |
| Molecular Formula | C25H16N4O2S3 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | (5Z)-5-[[3-(1,3-benzothiazol-2-yl)-1-phenylpyrazol-4-yl]methylidene]-3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cn(-c3ccccc3)nc2-c2nc3ccccc3s2)SC(=S)N1Cc1ccco1 |
| InChI | InChI=1S/C25H16N4O2S3/c30-24-21(34-25(32)28(24)15-18-9-6-12-31-18)13-16-14-29(17-7-2-1-3-8-17)27-22(16)23-26-19-10-4-5-11-20(19)33-23/h1-14H,15H2/b21-13- |
| InChIKey | BTBLJXRSACYMIK-BKUYFWCQSA-N |
| XLogP | 6.14 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|