C19H18N2O7S3 — CID 58650763
2-[(5Z)-5-[(E,4Z)-2-methyl-4-[3-(2-sulfoethyl)-1,3-benzoxazol-2-ylidene]but-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 58650763) has the molecular formula C19H18N2O7S3 and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-[(5Z)-5-[(E,4Z)-2-methyl-4-[3-(2-sulfoethyl)-1,3-benzoxazol-2-ylidene]but-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[(E,4Z)-2-methyl-4-[3-(2-sulfoethyl)-1,3-benzoxazol-2-ylidene]but-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 58650763 |
| Molecular Formula | C19H18N2O7S3 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | 2-[(5Z)-5-[(E,4Z)-2-methyl-4-[3-(2-sulfoethyl)-1,3-benzoxazol-2-ylidene]but-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CC(/C=C1\SC(=S)N(CC(=O)O)C1=O)=C\C=C1/Oc2ccccc2N1CCS(=O)(=O)O |
| InChI | InChI=1S/C19H18N2O7S3/c1-12(10-15-18(24)21(11-17(22)23)19(29)30-15)6-7-16-20(8-9-31(25,26)27)13-4-2-3-5-14(13)28-16/h2-7,10H,8-9,11H2,1H3,(H,22,23)(H,25,26,27)/b12-6+,15-10-,16-7- |
| InChIKey | QPKFPZMZUANYMS-RRWWVAOVSA-N |
| XLogP | 2.39 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|