C20H19N3O7S2-2 — CID 59937624
2-[(4E)-3-methyl-4-[(E,4Z)-2-methyl-4-[3-(2-sulfonatoethyl)-1,3-benzoxazol-2-ylidene]but-2-enylidene]-5-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 59937624) has the molecular formula C20H19N3O7S2-2 and a molecular weight of 477.52 g/mol. Its IUPAC name is 2-[(4E)-3-methyl-4-[(E,4Z)-2-methyl-4-[3-(2-sulfonatoethyl)-1,3-benzoxazol-2-ylidene]but-2-enylidene]-5-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | 2-[(4E)-3-methyl-4-[(E,4Z)-2-methyl-4-[3-(2-sulfonatoethyl)-1,3-benzoxazol-2-ylidene]but-2-enylidene]-5-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 59937624 |
| Molecular Formula | C20H19N3O7S2-2 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 2-[(4E)-3-methyl-4-[(E,4Z)-2-methyl-4-[3-(2-sulfonatoethyl)-1,3-benzoxazol-2-ylidene]but-2-enylidene]-5-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CC(=C\C=C1/Oc2ccccc2N1CCS(=O)(=O)[O-])/C=C1\C(=O)N(CC(=O)[O-])C(=S)N1C |
| InChI | InChI=1S/C20H21N3O7S2/c1-13(11-15-19(26)23(12-18(24)25)20(31)21(15)2)7-8-17-22(9-10-32(27,28)29)14-5-3-4-6-16(14)30-17/h3-8,11H,9-10,12H2,1-2H3,(H,24,25)(H,27,28,29)/p-2/b13-7+,15-11+,17-8- |
| InChIKey | ASQJLQMJFVSIET-KLCBFHPJSA-L |
| XLogP | -0.09 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|