C19H21NO7S — CID 164760892
2-(2-methylprop-2-enoyloxy)ethyl (Z,4Z)-4-(3-methyl-1,3-benzoxazol-2-ylidene)-2-methylsulfonylbut-2-enoate (PubChem CID 164760892) has the molecular formula C19H21NO7S and a molecular weight of 407.44 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl (Z,4Z)-4-(3-methyl-1,3-benzoxazol-2-ylidene)-2-methylsulfonylbut-2-enoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl (Z,4Z)-4-(3-methyl-1,3-benzoxazol-2-ylidene)-2-methylsulfonylbut-2-enoate |
|---|---|
| PubChem CID | 164760892 |
| Molecular Formula | C19H21NO7S |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl (Z,4Z)-4-(3-methyl-1,3-benzoxazol-2-ylidene)-2-methylsulfonylbut-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)/C(=C/C=C1\Oc2ccccc2N1C)S(C)(=O)=O |
| InChI | InChI=1S/C19H21NO7S/c1-13(2)18(21)25-11-12-26-19(22)16(28(4,23)24)9-10-17-20(3)14-7-5-6-8-15(14)27-17/h5-10H,1,11-12H2,2-4H3/b16-9-,17-10- |
| InChIKey | YSDHCPCFNLFOCM-CQRYCMKKSA-N |
| XLogP | 1.95 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|