C26H25NO7 — CID 164760887
2-(2-methylprop-2-enoyloxy)ethyl (E,4Z)-2-(4-methoxybenzoyl)-4-(3-methyl-1,3-benzoxazol-2-ylidene)but-2-enoate (PubChem CID 164760887) has the molecular formula C26H25NO7 and a molecular weight of 463.49 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl (E,4Z)-2-(4-methoxybenzoyl)-4-(3-methyl-1,3-benzoxazol-2-ylidene)but-2-enoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl (E,4Z)-2-(4-methoxybenzoyl)-4-(3-methyl-1,3-benzoxazol-2-ylidene)but-2-enoate |
|---|---|
| PubChem CID | 164760887 |
| Molecular Formula | C26H25NO7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl (E,4Z)-2-(4-methoxybenzoyl)-4-(3-methyl-1,3-benzoxazol-2-ylidene)but-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)/C(=C/C=C1\Oc2ccccc2N1C)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H25NO7/c1-17(2)25(29)32-15-16-33-26(30)20(24(28)18-9-11-19(31-4)12-10-18)13-14-23-27(3)21-7-5-6-8-22(21)34-23/h5-14H,1,15-16H2,2-4H3/b20-13+,23-14- |
| InChIKey | HPRCYTUBPCQZCS-ALZGGJCBSA-N |
| XLogP | 3.84 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|