C17H18O8 — CID 89191635
[(Z)-2-[2-[2-(4-methoxyphenyl)-2-oxoacetyl]oxyethylperoxy]ethenyl] 2-methylprop-2-enoate (PubChem CID 89191635) has the molecular formula C17H18O8 and a molecular weight of 350.32 g/mol. Its IUPAC name is [(Z)-2-[2-[2-(4-methoxyphenyl)-2-oxoacetyl]oxyethylperoxy]ethenyl] 2-methylprop-2-enoate.
| Compound Name | [(Z)-2-[2-[2-(4-methoxyphenyl)-2-oxoacetyl]oxyethylperoxy]ethenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89191635 |
| Molecular Formula | C17H18O8 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | [(Z)-2-[2-[2-(4-methoxyphenyl)-2-oxoacetyl]oxyethylperoxy]ethenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O/C=C\OOCCOC(=O)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H18O8/c1-12(2)16(19)22-8-10-24-25-11-9-23-17(20)15(18)13-4-6-14(21-3)7-5-13/h4-8,10H,1,9,11H2,2-3H3/b10-8- |
| InChIKey | WWCWJUYRRLNCNC-NTMALXAHSA-N |
| XLogP | 1.96 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|