C19H22O9 — CID 161360758
[(Z)-2-[2-[2-(3,4-dimethoxyphenyl)-2-oxoacetyl]oxyethylperoxy]ethenyl] prop-2-enoate;ethene (PubChem CID 161360758) has the molecular formula C19H22O9 and a molecular weight of 394.38 g/mol. Its IUPAC name is [(Z)-2-[2-[2-(3,4-dimethoxyphenyl)-2-oxoacetyl]oxyethylperoxy]ethenyl] prop-2-enoate;ethene.
| Compound Name | [(Z)-2-[2-[2-(3,4-dimethoxyphenyl)-2-oxoacetyl]oxyethylperoxy]ethenyl] prop-2-enoate;ethene |
|---|---|
| PubChem CID | 161360758 |
| Molecular Formula | C19H22O9 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [(Z)-2-[2-[2-(3,4-dimethoxyphenyl)-2-oxoacetyl]oxyethylperoxy]ethenyl] prop-2-enoate;ethene |
| SMILES | C=C.C=CC(=O)O/C=C\OOCCOC(=O)C(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H18O9.C2H4/c1-4-15(18)23-7-9-25-26-10-8-24-17(20)16(19)12-5-6-13(21-2)14(11-12)22-3;1-2/h4-7,9,11H,1,8,10H2,2-3H3;1-2H2/b9-7-; |
| InChIKey | VPDGWTAJWSXVRP-VILQZVERSA-N |
| XLogP | 2.38 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|