C17H18O9 — CID 89488762
[(Z)-2-[2-[2-[3,4-bis(hydroxymethyl)phenyl]-2-oxoacetyl]oxyethylperoxy]ethenyl] prop-2-enoate (PubChem CID 89488762) has the molecular formula C17H18O9 and a molecular weight of 366.32 g/mol. Its IUPAC name is [(Z)-2-[2-[2-[3,4-bis(hydroxymethyl)phenyl]-2-oxoacetyl]oxyethylperoxy]ethenyl] prop-2-enoate.
| Compound Name | [(Z)-2-[2-[2-[3,4-bis(hydroxymethyl)phenyl]-2-oxoacetyl]oxyethylperoxy]ethenyl] prop-2-enoate |
|---|---|
| PubChem CID | 89488762 |
| Molecular Formula | C17H18O9 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [(Z)-2-[2-[2-[3,4-bis(hydroxymethyl)phenyl]-2-oxoacetyl]oxyethylperoxy]ethenyl] prop-2-enoate |
| SMILES | C=CC(=O)O/C=C\OOCCOC(=O)C(=O)c1ccc(CO)c(CO)c1 |
| InChI | InChI=1S/C17H18O9/c1-2-15(20)23-5-7-25-26-8-6-24-17(22)16(21)12-3-4-13(10-18)14(9-12)11-19/h2-5,7,9,18-19H,1,6,8,10-11H2/b7-5- |
| InChIKey | RCZDTEKKHIDQON-ALCCZGGFSA-N |
| XLogP | 0.55 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|