C20H20O7 — CID 143834320
2-[2-(2-oxo-2-phenylacetyl)oxyethoxy]ethyl (3E)-3-ethenyl-2-oxohexa-3,5-dienoate (PubChem CID 143834320) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is 2-[2-(2-oxo-2-phenylacetyl)oxyethoxy]ethyl (3E)-3-ethenyl-2-oxohexa-3,5-dienoate.
| Compound Name | 2-[2-(2-oxo-2-phenylacetyl)oxyethoxy]ethyl (3E)-3-ethenyl-2-oxohexa-3,5-dienoate |
|---|---|
| PubChem CID | 143834320 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[2-(2-oxo-2-phenylacetyl)oxyethoxy]ethyl (3E)-3-ethenyl-2-oxohexa-3,5-dienoate |
| SMILES | C=C/C=C(\C=C)C(=O)C(=O)OCCOCCOC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20O7/c1-3-8-15(4-2)17(21)19(23)26-13-11-25-12-14-27-20(24)18(22)16-9-6-5-7-10-16/h3-10H,1-2,11-14H2/b15-8+ |
| InChIKey | IGQBKIBPOQGRBF-OVCLIPMQSA-N |
| XLogP | 1.84 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|