About ethenoxymethyl 2-oxo-2-phenylacetate
ethenoxymethyl 2-oxo-2-phenylacetate (PubChem CID 89488729) has the molecular formula C11H10O4
and a molecular weight of 206.20 g/mol. Its IUPAC name is ethenoxymethyl 2-oxo-2-phenylacetate.
Molecular Properties
| Compound Name | ethenoxymethyl 2-oxo-2-phenylacetate |
| PubChem CID | 89488729 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | ethenoxymethyl 2-oxo-2-phenylacetate |
| SMILES | C=COCOC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C11H10O4/c1-2-14-8-15-11(13)10(12)9-6-4-3-5-7-9/h2-7H,1,8H2 |
| InChIKey | ZDTHMMWXVMZKJA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethenoxymethyl 2-oxo-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxymethyl 2-oxo-2-phenylacetate?
The IUPAC name of ethenoxymethyl 2-oxo-2-phenylacetate (CID 89488729) is ethenoxymethyl 2-oxo-2-phenylacetate.
What is the SMILES notation for ethenoxymethyl 2-oxo-2-phenylacetate?
The canonical SMILES for ethenoxymethyl 2-oxo-2-phenylacetate is C=COCOC(=O)C(=O)c1ccccc1.
What is the InChIKey of ethenoxymethyl 2-oxo-2-phenylacetate?
The InChIKey is ZDTHMMWXVMZKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O4/c1-2-14-8-15-11(13)10(12)9-6-4-3-5-7-9/h2-7H,1,8H2.
What are the key properties of ethenoxymethyl 2-oxo-2-phenylacetate?
ethenoxymethyl 2-oxo-2-phenylacetate has a molecular weight of 206.20 g/mol, XLogP of 1.53, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxymethyl 2-oxo-2-phenylacetate is sourced from PubChem (CID 89488729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).