C24H28O9 — CID 67777483
(4-methoxyphenyl)methanol;2-O-[(4-methoxyphenyl)methyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] oxalate (PubChem CID 67777483) has the molecular formula C24H28O9 and a molecular weight of 460.48 g/mol. Its IUPAC name is (4-methoxyphenyl)methanol;2-O-[(4-methoxyphenyl)methyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] oxalate.
| Compound Name | (4-methoxyphenyl)methanol;2-O-[(4-methoxyphenyl)methyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] oxalate |
|---|---|
| PubChem CID | 67777483 |
| Molecular Formula | C24H28O9 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (4-methoxyphenyl)methanol;2-O-[(4-methoxyphenyl)methyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] oxalate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(=O)OCc1ccc(OC)cc1.COc1ccc(CO)cc1 |
| InChI | InChI=1S/C16H18O7.C8H10O2/c1-11(2)14(17)21-8-9-22-15(18)16(19)23-10-12-4-6-13(20-3)7-5-12;1-10-8-4-2-7(6-9)3-5-8/h4-7H,1,8-10H2,2-3H3;2-5,9H,6H2,1H3 |
| InChIKey | IYHQPQJMMPORRG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|