C24H23NO7S — CID 164760910
2-(2-methylprop-2-enoyloxy)ethyl (Z,4Z)-2-(benzenesulfonyl)-4-(3-methyl-1,3-benzoxazol-2-ylidene)but-2-enoate (PubChem CID 164760910) has the molecular formula C24H23NO7S and a molecular weight of 469.52 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl (Z,4Z)-2-(benzenesulfonyl)-4-(3-methyl-1,3-benzoxazol-2-ylidene)but-2-enoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl (Z,4Z)-2-(benzenesulfonyl)-4-(3-methyl-1,3-benzoxazol-2-ylidene)but-2-enoate |
|---|---|
| PubChem CID | 164760910 |
| Molecular Formula | C24H23NO7S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl (Z,4Z)-2-(benzenesulfonyl)-4-(3-methyl-1,3-benzoxazol-2-ylidene)but-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)/C(=C/C=C1\Oc2ccccc2N1C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23NO7S/c1-17(2)23(26)30-15-16-31-24(27)21(33(28,29)18-9-5-4-6-10-18)13-14-22-25(3)19-11-7-8-12-20(19)32-22/h4-14H,1,15-16H2,2-3H3/b21-13-,22-14- |
| InChIKey | LSKALMPABBYSIE-JZTLMNBPSA-N |
| XLogP | 3.38 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|