C19H16N2O3 — CID 58705031
(1Z,3Z)-1,3-bis(3-methyl-1,3-benzoxazol-2-ylidene)propan-2-one (PubChem CID 58705031) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is (1Z,3Z)-1,3-bis(3-methyl-1,3-benzoxazol-2-ylidene)propan-2-one.
| Compound Name | (1Z,3Z)-1,3-bis(3-methyl-1,3-benzoxazol-2-ylidene)propan-2-one |
|---|---|
| PubChem CID | 58705031 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (1Z,3Z)-1,3-bis(3-methyl-1,3-benzoxazol-2-ylidene)propan-2-one |
| SMILES | CN1/C(=C/C(=O)/C=C2\Oc3ccccc3N2C)Oc2ccccc21 |
| InChI | InChI=1S/C19H16N2O3/c1-20-14-7-3-5-9-16(14)23-18(20)11-13(22)12-19-21(2)15-8-4-6-10-17(15)24-19/h3-12H,1-2H3/b18-11-,19-12- |
| InChIKey | GHJFRBNSKBBNTI-ZAORYEFMSA-N |
| XLogP | 3.30 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|