C21H21IN2O2 — CID 158733359
(2Z)-3-methyl-2-[(2Z)-2-[(3-methyl-1,3-benzoxazol-3-ium-2-yl)methylidene]butylidene]-1,3-benzoxazole iodide (PubChem CID 158733359) has the molecular formula C21H21IN2O2 and a molecular weight of 460.32 g/mol. Its IUPAC name is (2Z)-3-methyl-2-[(2Z)-2-[(3-methyl-1,3-benzoxazol-3-ium-2-yl)methylidene]butylidene]-1,3-benzoxazole iodide.
| Compound Name | (2Z)-3-methyl-2-[(2Z)-2-[(3-methyl-1,3-benzoxazol-3-ium-2-yl)methylidene]butylidene]-1,3-benzoxazole iodide |
|---|---|
| PubChem CID | 158733359 |
| Molecular Formula | C21H21IN2O2 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | (2Z)-3-methyl-2-[(2Z)-2-[(3-methyl-1,3-benzoxazol-3-ium-2-yl)methylidene]butylidene]-1,3-benzoxazole iodide |
| SMILES | CCC(=C/c1oc2ccccc2[n+]1C)/C=C1\Oc2ccccc2N1C.[I-] |
| InChI | InChI=1S/C21H21N2O2.HI/c1-4-15(13-20-22(2)16-9-5-7-11-18(16)24-20)14-21-23(3)17-10-6-8-12-19(17)25-21;/h5-14H,4H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UJJMBZXLEDWZLF-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 29.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|