C29H25N2O2+ — CID 91035053
(2E)-3-methyl-2-[(2Z)-2-[(3-methylbenzo[f][1,3]benzoxazol-3-ium-2-yl)methylidene]butylidene]benzo[f][1,3]benzoxazole (PubChem CID 91035053) has the molecular formula C29H25N2O2+ and a molecular weight of 433.53 g/mol. Its IUPAC name is (2E)-3-methyl-2-[(2Z)-2-[(3-methylbenzo[f][1,3]benzoxazol-3-ium-2-yl)methylidene]butylidene]benzo[f][1,3]benzoxazole.
| Compound Name | (2E)-3-methyl-2-[(2Z)-2-[(3-methylbenzo[f][1,3]benzoxazol-3-ium-2-yl)methylidene]butylidene]benzo[f][1,3]benzoxazole |
|---|---|
| PubChem CID | 91035053 |
| Molecular Formula | C29H25N2O2+ |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (2E)-3-methyl-2-[(2Z)-2-[(3-methylbenzo[f][1,3]benzoxazol-3-ium-2-yl)methylidene]butylidene]benzo[f][1,3]benzoxazole |
| SMILES | CCC(=C/c1oc2cc3ccccc3cc2[n+]1C)/C=C1/Oc2cc3ccccc3cc2N1C |
| InChI | InChI=1S/C29H25N2O2/c1-4-19(13-28-30(2)24-15-20-9-5-7-11-22(20)17-26(24)32-28)14-29-31(3)25-16-21-10-6-8-12-23(21)18-27(25)33-29/h5-18H,4H2,1-3H3/q+1 |
| InChIKey | LRFHEDOYEQYGPN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 29.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|