C32H31N2O5S+ — CID 14344129
3-[2-[(E)-2-[(Z)-(3-ethylbenzo[f][1,3]benzoxazol-2-ylidene)methyl]but-1-enyl]benzo[f][1,3]benzoxazol-3-ium-3-yl]propane-1-sulfonic acid (PubChem CID 14344129) has the molecular formula C32H31N2O5S+ and a molecular weight of 555.68 g/mol. Its IUPAC name is 3-[2-[(E)-2-[(Z)-(3-ethylbenzo[f][1,3]benzoxazol-2-ylidene)methyl]but-1-enyl]benzo[f][1,3]benzoxazol-3-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(E)-2-[(Z)-(3-ethylbenzo[f][1,3]benzoxazol-2-ylidene)methyl]but-1-enyl]benzo[f][1,3]benzoxazol-3-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 14344129 |
| Molecular Formula | C32H31N2O5S+ |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 3-[2-[(E)-2-[(Z)-(3-ethylbenzo[f][1,3]benzoxazol-2-ylidene)methyl]but-1-enyl]benzo[f][1,3]benzoxazol-3-ium-3-yl]propane-1-sulfonic acid |
| SMILES | CCC(/C=C1\Oc2cc3ccccc3cc2N1CC)=C\c1oc2cc3ccccc3cc2[n+]1CCCS(=O)(=O)O |
| InChI | InChI=1S/C32H30N2O5S/c1-3-22(16-31-33(4-2)27-18-23-10-5-7-12-25(23)20-29(27)38-31)17-32-34(14-9-15-40(35,36)37)28-19-24-11-6-8-13-26(24)21-30(28)39-32/h5-8,10-13,16-21H,3-4,9,14-15H2,1-2H3/p+1 |
| InChIKey | FLORHIKMOZXKAS-UHFFFAOYSA-O |
| XLogP | 6.86 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|