C35H36N2NaO8S2+ — CID 59100656
sodium 4-[2-[2-[[3-(4-sulfobutyl)benzo[f][1,3]benzoxazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]butane-2-sulfonate (PubChem CID 59100656) has the molecular formula C35H36N2NaO8S2+ and a molecular weight of 699.80 g/mol. Its IUPAC name is sodium 4-[2-[2-[[3-(4-sulfobutyl)benzo[f][1,3]benzoxazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]butane-2-sulfonate.
| Compound Name | sodium 4-[2-[2-[[3-(4-sulfobutyl)benzo[f][1,3]benzoxazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]butane-2-sulfonate |
|---|---|
| PubChem CID | 59100656 |
| Molecular Formula | C35H36N2NaO8S2+ |
| Molecular Weight | 699.80 g/mol |
| Exact Mass | 699.18 |
| IUPAC Name | sodium 4-[2-[2-[[3-(4-sulfobutyl)benzo[f][1,3]benzoxazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]butane-2-sulfonate |
| SMILES | CCC(=Cc1oc2ccc3ccccc3c2[n+]1CCC(C)S(=O)(=O)[O-])C=C1Oc2cc3ccccc3cc2N1CCCCS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C35H36N2O8S2.Na/c1-3-25(20-33-36(17-8-9-19-46(38,39)40)30-22-27-11-4-5-12-28(27)23-32(30)45-33)21-34-37(18-16-24(2)47(41,42)43)35-29-13-7-6-10-26(29)14-15-31(35)44-34;/h4-7,10-15,20-24H,3,8-9,16-19H2,1-2H3,(H-,38,39,40,41,42,43);/q;+1 |
| InChIKey | VUSUHOFNGLWCBE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|