C30H31ClN2O6S3 — CID 59950433
3-[2-[(Z)-2-[(E)-[5-chloro-3-(4-sulfobutyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfinate (PubChem CID 59950433) has the molecular formula C30H31ClN2O6S3 and a molecular weight of 647.24 g/mol. Its IUPAC name is 3-[2-[(Z)-2-[(E)-[5-chloro-3-(4-sulfobutyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfinate.
| Compound Name | 3-[2-[(Z)-2-[(E)-[5-chloro-3-(4-sulfobutyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfinate |
|---|---|
| PubChem CID | 59950433 |
| Molecular Formula | C30H31ClN2O6S3 |
| Molecular Weight | 647.24 g/mol |
| Exact Mass | 646.10 |
| IUPAC Name | 3-[2-[(Z)-2-[(E)-[5-chloro-3-(4-sulfobutyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfinate |
| SMILES | CCC(=C/c1oc2ccc3ccccc3c2[n+]1CCCS(=O)[O-])/C=C1/Sc2ccc(Cl)cc2N1CCCCS(=O)(=O)O |
| InChI | InChI=1S/C30H31ClN2O6S3/c1-2-21(19-29-32(14-5-6-17-42(36,37)38)25-20-23(31)11-13-27(25)40-29)18-28-33(15-7-16-41(34)35)30-24-9-4-3-8-22(24)10-12-26(30)39-28/h3-4,8-13,18-20H,2,5-7,14-17H2,1H3,(H-,34,35,36,37,38) |
| InChIKey | KXSIFDBZJTYCLI-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.24 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|