C28H27ClN3O7S3+ — CID 20751221
3-[2-[(E,3Z)-3-[5-chloro-3-[2-(methanesulfonamido)-2-oxoethyl]-1,3-benzothiazol-2-ylidene]-2-methylprop-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 20751221) has the molecular formula C28H27ClN3O7S3+ and a molecular weight of 649.19 g/mol. Its IUPAC name is 3-[2-[(E,3Z)-3-[5-chloro-3-[2-(methanesulfonamido)-2-oxoethyl]-1,3-benzothiazol-2-ylidene]-2-methylprop-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(E,3Z)-3-[5-chloro-3-[2-(methanesulfonamido)-2-oxoethyl]-1,3-benzothiazol-2-ylidene]-2-methylprop-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 20751221 |
| Molecular Formula | C28H27ClN3O7S3+ |
| Molecular Weight | 649.19 g/mol |
| Exact Mass | 648.07 |
| IUPAC Name | 3-[2-[(E,3Z)-3-[5-chloro-3-[2-(methanesulfonamido)-2-oxoethyl]-1,3-benzothiazol-2-ylidene]-2-methylprop-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CC(/C=C1\Sc2ccc(Cl)cc2N1CC(=O)NS(C)(=O)=O)=C\c1oc2ccc3ccccc3c2[n+]1CCCS(=O)(=O)O |
| InChI | InChI=1S/C28H26ClN3O7S3/c1-18(15-27-32(17-25(33)30-41(2,34)35)22-16-20(29)9-11-24(22)40-27)14-26-31(12-5-13-42(36,37)38)28-21-7-4-3-6-19(21)8-10-23(28)39-26/h3-4,6-11,14-16H,5,12-13,17H2,1-2H3,(H-,30,33,36,37,38)/p+1 |
| InChIKey | SIHFSNXEUFWVRO-UHFFFAOYSA-O |
| XLogP | 4.74 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.19 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|