C25H22ClN2OS+ — CID 89302786
2-[2-[(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-1-methylbenzo[e][1,3]benzoxazol-1-ium (PubChem CID 89302786) has the molecular formula C25H22ClN2OS+ and a molecular weight of 433.98 g/mol. Its IUPAC name is 2-[2-[(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-1-methylbenzo[e][1,3]benzoxazol-1-ium.
| Compound Name | 2-[2-[(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-1-methylbenzo[e][1,3]benzoxazol-1-ium |
|---|---|
| PubChem CID | 89302786 |
| Molecular Formula | C25H22ClN2OS+ |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 2-[2-[(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-1-methylbenzo[e][1,3]benzoxazol-1-ium |
| SMILES | CCC(=Cc1oc2ccc3ccccc3c2[n+]1C)C=C1Sc2ccc(Cl)cc2N1C |
| InChI | InChI=1S/C25H22ClN2OS/c1-4-16(14-24-27(2)20-15-18(26)10-12-22(20)30-24)13-23-28(3)25-19-8-6-5-7-17(19)9-11-21(25)29-23/h5-15H,4H2,1-3H3/q+1 |
| InChIKey | MBDQILSLMGNMEE-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|