C25H20ClN2S+ — CID 177485663
(2Z)-5-chloro-3-methyl-2-[(1-methyl-4-naphthalen-1-ylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole (PubChem CID 177485663) has the molecular formula C25H20ClN2S+ and a molecular weight of 415.97 g/mol. Its IUPAC name is (2Z)-5-chloro-3-methyl-2-[(1-methyl-4-naphthalen-1-ylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole.
| Compound Name | (2Z)-5-chloro-3-methyl-2-[(1-methyl-4-naphthalen-1-ylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 177485663 |
| Molecular Formula | C25H20ClN2S+ |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (2Z)-5-chloro-3-methyl-2-[(1-methyl-4-naphthalen-1-ylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole |
| SMILES | CN1/C(=C/c2cc(-c3cccc4ccccc34)cc[n+]2C)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H20ClN2S/c1-27-13-12-18(22-9-5-7-17-6-3-4-8-21(17)22)14-20(27)16-25-28(2)23-15-19(26)10-11-24(23)29-25/h3-16H,1-2H3/q+1 |
| InChIKey | VTMHIDUIHUHTKG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|