C21H20ClN2OS+ — CID 134100980
(2Z)-2-[(7-chloro-1-methylquinolin-1-ium-2-yl)methylidene]-6-ethoxy-3-methyl-1,3-benzothiazole (PubChem CID 134100980) has the molecular formula C21H20ClN2OS+ and a molecular weight of 383.92 g/mol. Its IUPAC name is (2Z)-2-[(7-chloro-1-methylquinolin-1-ium-2-yl)methylidene]-6-ethoxy-3-methyl-1,3-benzothiazole.
| Compound Name | (2Z)-2-[(7-chloro-1-methylquinolin-1-ium-2-yl)methylidene]-6-ethoxy-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 134100980 |
| Molecular Formula | C21H20ClN2OS+ |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | (2Z)-2-[(7-chloro-1-methylquinolin-1-ium-2-yl)methylidene]-6-ethoxy-3-methyl-1,3-benzothiazole |
| SMILES | CCOc1ccc2c(c1)S/C(=C\c1ccc3ccc(Cl)cc3[n+]1C)N2C |
| InChI | InChI=1S/C21H20ClN2OS/c1-4-25-17-9-10-18-20(13-17)26-21(24(18)3)12-16-8-6-14-5-7-15(22)11-19(14)23(16)2/h5-13H,4H2,1-3H3/q+1 |
| InChIKey | KWXATBZGRLPLBQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|