C22H24N2O5S2 — CID 134100975
(2Z)-6-ethoxy-3-methyl-2-[(1-methylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazole;methyl sulfate (PubChem CID 134100975) has the molecular formula C22H24N2O5S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (2Z)-6-ethoxy-3-methyl-2-[(1-methylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazole;methyl sulfate.
| Compound Name | (2Z)-6-ethoxy-3-methyl-2-[(1-methylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazole;methyl sulfate |
|---|---|
| PubChem CID | 134100975 |
| Molecular Formula | C22H24N2O5S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | (2Z)-6-ethoxy-3-methyl-2-[(1-methylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazole;methyl sulfate |
| SMILES | CCOc1ccc2c(c1)S/C(=C\c1ccc3ccccc3[n+]1C)N2C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C21H21N2OS.CH4O4S/c1-4-24-17-11-12-19-20(14-17)25-21(23(19)3)13-16-10-9-15-7-5-6-8-18(15)22(16)2;1-5-6(2,3)4/h5-14H,4H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | IFAJSEZBEULLRM-UHFFFAOYSA-M |
| XLogP | 3.70 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|