C17H18N2O6S2 — CID 158428537
7-methyl-6-[(1-methylpyridin-1-ium-2-yl)methylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole;methyl sulfate (PubChem CID 158428537) has the molecular formula C17H18N2O6S2 and a molecular weight of 410.47 g/mol. Its IUPAC name is 7-methyl-6-[(1-methylpyridin-1-ium-2-yl)methylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole;methyl sulfate.
| Compound Name | 7-methyl-6-[(1-methylpyridin-1-ium-2-yl)methylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole;methyl sulfate |
|---|---|
| PubChem CID | 158428537 |
| Molecular Formula | C17H18N2O6S2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 7-methyl-6-[(1-methylpyridin-1-ium-2-yl)methylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole;methyl sulfate |
| SMILES | CN1C(=Cc2cccc[n+]2C)Sc2cc3c(cc21)OCO3.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H15N2O2S.CH4O4S/c1-17-6-4-3-5-11(17)7-16-18(2)12-8-13-14(20-10-19-13)9-15(12)21-16;1-5-6(2,3)4/h3-9H,10H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | HBJBEMGYEVIEBO-UHFFFAOYSA-M |
| XLogP | 1.87 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|