C16H15N2O2S+ — CID 75984173
7-methyl-6-[(1-methylpyridin-1-ium-4-yl)methylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole (PubChem CID 75984173) has the molecular formula C16H15N2O2S+ and a molecular weight of 299.38 g/mol. Its IUPAC name is 7-methyl-6-[(1-methylpyridin-1-ium-4-yl)methylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole.
| Compound Name | 7-methyl-6-[(1-methylpyridin-1-ium-4-yl)methylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 75984173 |
| Molecular Formula | C16H15N2O2S+ |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 7-methyl-6-[(1-methylpyridin-1-ium-4-yl)methylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
| SMILES | CN1C(=Cc2cc[n+](C)cc2)Sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C16H15N2O2S/c1-17-5-3-11(4-6-17)7-16-18(2)12-8-13-14(20-10-19-13)9-15(12)21-16/h3-9H,10H2,1-2H3/q+1 |
| InChIKey | ALJRLYRAYHUFET-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|