C17H20N3S+ — CID 176596581
N,N,1-trimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-2-amine (PubChem CID 176596581) has the molecular formula C17H20N3S+ and a molecular weight of 298.44 g/mol. Its IUPAC name is N,N,1-trimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-2-amine.
| Compound Name | N,N,1-trimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 176596581 |
| Molecular Formula | C17H20N3S+ |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N,N,1-trimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-2-amine |
| SMILES | CN(C)c1cc(/C=C2\Sc3ccccc3N2C)cc[n+]1C |
| InChI | InChI=1S/C17H20N3S/c1-18(2)16-11-13(9-10-19(16)3)12-17-20(4)14-7-5-6-8-15(14)21-17/h5-12H,1-4H3/q+1 |
| InChIKey | AFKOIELKDLWYPP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|