C16H18N3S+ — CID 59079256
3-methyl-2-[(1,4,6-trimethylpyrimidin-1-ium-2-yl)methylidene]-1,3-benzothiazole (PubChem CID 59079256) has the molecular formula C16H18N3S+ and a molecular weight of 284.41 g/mol. Its IUPAC name is 3-methyl-2-[(1,4,6-trimethylpyrimidin-1-ium-2-yl)methylidene]-1,3-benzothiazole.
| Compound Name | 3-methyl-2-[(1,4,6-trimethylpyrimidin-1-ium-2-yl)methylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 59079256 |
| Molecular Formula | C16H18N3S+ |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-methyl-2-[(1,4,6-trimethylpyrimidin-1-ium-2-yl)methylidene]-1,3-benzothiazole |
| SMILES | Cc1cc(C)[n+](C)c(C=C2Sc3ccccc3N2C)n1 |
| InChI | InChI=1S/C16H18N3S/c1-11-9-12(2)18(3)15(17-11)10-16-19(4)13-7-5-6-8-14(13)20-16/h5-10H,1-4H3/q+1 |
| InChIKey | OQLGWKYEBNAQFD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|