C23H23IN2OS — CID 131955257
2-[[1-(2-methoxyphenyl)-2,6-dimethylpyridin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole iodide (PubChem CID 131955257) has the molecular formula C23H23IN2OS and a molecular weight of 502.42 g/mol. Its IUPAC name is 2-[[1-(2-methoxyphenyl)-2,6-dimethylpyridin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole iodide.
| Compound Name | 2-[[1-(2-methoxyphenyl)-2,6-dimethylpyridin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 131955257 |
| Molecular Formula | C23H23IN2OS |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 2-[[1-(2-methoxyphenyl)-2,6-dimethylpyridin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole iodide |
| SMILES | COc1ccccc1-[n+]1c(C)cc(C=C2Sc3ccccc3N2C)cc1C.[I-] |
| InChI | InChI=1S/C23H23N2OS.HI/c1-16-13-18(15-23-24(3)20-10-6-8-12-22(20)27-23)14-17(2)25(16)19-9-5-7-11-21(19)26-4;/h5-15H,1-4H3;1H/q+1;/p-1 |
| InChIKey | GVKHGPUYRQYOGC-UHFFFAOYSA-M |
| XLogP | 2.13 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|