C25H22IN3OS — CID 87227418
(2E)-2-[(6-methoxy-1-methyl-2-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole iodide (PubChem CID 87227418) has the molecular formula C25H22IN3OS and a molecular weight of 539.44 g/mol. Its IUPAC name is (2E)-2-[(6-methoxy-1-methyl-2-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole iodide.
| Compound Name | (2E)-2-[(6-methoxy-1-methyl-2-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 87227418 |
| Molecular Formula | C25H22IN3OS |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | (2E)-2-[(6-methoxy-1-methyl-2-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole iodide |
| SMILES | COc1ccc2c(c1)c(/C=C1/Sc3ccccc3N1C)nc(-c1ccccc1)[n+]2C.[I-] |
| InChI | InChI=1S/C25H22N3OS.HI/c1-27-22-11-7-8-12-23(22)30-24(27)16-20-19-15-18(29-3)13-14-21(19)28(2)25(26-20)17-9-5-4-6-10-17;/h4-16H,1-3H3;1H/q+1;/p-1 |
| InChIKey | PMRRBIRNHYDRRQ-UHFFFAOYSA-M |
| XLogP | 2.28 |
| TPSA | 29.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|