C33H28N5S2+ — CID 135471799
2-[2,3,5,6-tetramethyl-4-[9-methyl-2-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyrrolo[3,2-b][1,4]benzothiazin-9-ium-3-yl]phenyl]propanedinitrile (PubChem CID 135471799) has the molecular formula C33H28N5S2+ and a molecular weight of 558.76 g/mol. Its IUPAC name is 2-[2,3,5,6-tetramethyl-4-[9-methyl-2-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyrrolo[3,2-b][1,4]benzothiazin-9-ium-3-yl]phenyl]propanedinitrile.
| Compound Name | 2-[2,3,5,6-tetramethyl-4-[9-methyl-2-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyrrolo[3,2-b][1,4]benzothiazin-9-ium-3-yl]phenyl]propanedinitrile |
|---|---|
| PubChem CID | 135471799 |
| Molecular Formula | C33H28N5S2+ |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 2-[2,3,5,6-tetramethyl-4-[9-methyl-2-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyrrolo[3,2-b][1,4]benzothiazin-9-ium-3-yl]phenyl]propanedinitrile |
| SMILES | Cc1c(C)c(C(C#N)C#N)c(C)c(C)c1-c1c(/C=C2\Sc3ccccc3N2C)nc2[n+](C)c3ccccc3sc1-2 |
| InChI | InChI=1S/C33H28N5S2/c1-18-20(3)30(21(4)19(2)29(18)22(16-34)17-35)31-23(15-28-37(5)24-11-7-9-13-26(24)39-28)36-33-32(31)40-27-14-10-8-12-25(27)38(33)6/h7-15,22H,1-6H3/q+1 |
| InChIKey | YUSGVMNPXYIOQD-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|