C25H25N2O2S2+ — CID 122534805
(2Z)-6-methoxy-2-[(2E,4E,6E)-7-(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-3-methyl-1,3-benzothiazole (PubChem CID 122534805) has the molecular formula C25H25N2O2S2+ and a molecular weight of 449.62 g/mol. Its IUPAC name is (2Z)-6-methoxy-2-[(2E,4E,6E)-7-(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-3-methyl-1,3-benzothiazole.
| Compound Name | (2Z)-6-methoxy-2-[(2E,4E,6E)-7-(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 122534805 |
| Molecular Formula | C25H25N2O2S2+ |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | (2Z)-6-methoxy-2-[(2E,4E,6E)-7-(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-3-methyl-1,3-benzothiazole |
| SMILES | COc1ccc2c(c1)S/C(=C\C=C\C=C\C=C\c1sc3cc(OC)ccc3[n+]1C)N2C |
| InChI | InChI=1S/C25H25N2O2S2/c1-26-20-14-12-18(28-3)16-22(20)30-24(26)10-8-6-5-7-9-11-25-27(2)21-15-13-19(29-4)17-23(21)31-25/h5-17H,1-4H3/q+1 |
| InChIKey | MMMZAHPQJJKPAO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|