C20H20N3S+ — CID 59034857
2-[3-(1,3-dimethylbenzimidazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium (PubChem CID 59034857) has the molecular formula C20H20N3S+ and a molecular weight of 334.47 g/mol. Its IUPAC name is 2-[3-(1,3-dimethylbenzimidazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[3-(1,3-dimethylbenzimidazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 59034857 |
| Molecular Formula | C20H20N3S+ |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-[3-(1,3-dimethylbenzimidazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium |
| SMILES | CN1C(=CC=Cc2sc3ccccc3[n+]2C)N(C)c2ccccc21 |
| InChI | InChI=1S/C20H20N3S/c1-21-15-9-4-5-10-16(15)22(2)19(21)13-8-14-20-23(3)17-11-6-7-12-18(17)24-20/h4-14H,1-3H3/q+1 |
| InChIKey | DGRXAPOJKJIUGT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|