C21H27N2OS+ — CID 54402971
ethane;3-methyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzoxazole (PubChem CID 54402971) has the molecular formula C21H27N2OS+ and a molecular weight of 355.53 g/mol. Its IUPAC name is ethane;3-methyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzoxazole.
| Compound Name | ethane;3-methyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzoxazole |
|---|---|
| PubChem CID | 54402971 |
| Molecular Formula | C21H27N2OS+ |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | ethane;3-methyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzoxazole |
| SMILES | CC.CC.CN1C(=Cc2sc3ccccc3[n+]2C)Oc2ccccc21 |
| InChI | InChI=1S/C17H15N2OS.2C2H6/c1-18-12-7-3-5-9-14(12)20-16(18)11-17-19(2)13-8-4-6-10-15(13)21-17;2*1-2/h3-11H,1-2H3;2*1-2H3/q+1;; |
| InChIKey | VOSXQBNIFJNAOC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|