C25H20N3O4S2+ — CID 72611398
2-[5-isocyano-2-[(3-methyl-5-phenyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzoxazol-3-yl]ethanesulfonic acid (PubChem CID 72611398) has the molecular formula C25H20N3O4S2+ and a molecular weight of 490.59 g/mol. Its IUPAC name is 2-[5-isocyano-2-[(3-methyl-5-phenyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzoxazol-3-yl]ethanesulfonic acid.
| Compound Name | 2-[5-isocyano-2-[(3-methyl-5-phenyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzoxazol-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 72611398 |
| Molecular Formula | C25H20N3O4S2+ |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 2-[5-isocyano-2-[(3-methyl-5-phenyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzoxazol-3-yl]ethanesulfonic acid |
| SMILES | [C-]#[N+]c1ccc2c(c1)N(CCS(=O)(=O)O)C(=Cc1sc3ccc(-c4ccccc4)cc3[n+]1C)O2 |
| InChI | InChI=1S/C25H19N3O4S2/c1-26-19-9-10-22-20(15-19)28(12-13-34(29,30)31)24(32-22)16-25-27(2)21-14-18(8-11-23(21)33-25)17-6-4-3-5-7-17/h3-11,14-16H,12-13H2,2H3/p+1 |
| InChIKey | SZDCQHKZDGSOHA-UHFFFAOYSA-O |
| XLogP | 5.03 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|