C26H27NO2S2 — CID 122536650
(2Z)-6-methoxy-2-[(2E,4E,6E)-8-(5-methoxy-2-methylphenyl)sulfanylnona-2,4,6,8-tetraenylidene]-3-methyl-1,3-benzothiazole (PubChem CID 122536650) has the molecular formula C26H27NO2S2 and a molecular weight of 449.64 g/mol. Its IUPAC name is (2Z)-6-methoxy-2-[(2E,4E,6E)-8-(5-methoxy-2-methylphenyl)sulfanylnona-2,4,6,8-tetraenylidene]-3-methyl-1,3-benzothiazole.
| Compound Name | (2Z)-6-methoxy-2-[(2E,4E,6E)-8-(5-methoxy-2-methylphenyl)sulfanylnona-2,4,6,8-tetraenylidene]-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 122536650 |
| Molecular Formula | C26H27NO2S2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (2Z)-6-methoxy-2-[(2E,4E,6E)-8-(5-methoxy-2-methylphenyl)sulfanylnona-2,4,6,8-tetraenylidene]-3-methyl-1,3-benzothiazole |
| SMILES | C=C(/C=C/C=C/C=C/C=C1\Sc2cc(OC)ccc2N1C)Sc1cc(OC)ccc1C |
| InChI | InChI=1S/C26H27NO2S2/c1-19-13-14-21(28-4)17-24(19)30-20(2)11-9-7-6-8-10-12-26-27(3)23-16-15-22(29-5)18-25(23)31-26/h6-18H,2H2,1,3-5H3/b7-6+,10-8+,11-9+,26-12- |
| InChIKey | DQXKRZDPIFYFQM-XVBPFFPSSA-N |
| XLogP | 7.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|