C26H31N5O2S — CID 72720504
[N-[4-[6,7-dimethoxy-1-methyl-4-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-2-yl]butyl]-C-methylcarbonimidoyl]azanide (PubChem CID 72720504) has the molecular formula C26H31N5O2S and a molecular weight of 477.63 g/mol. Its IUPAC name is [N-[4-[6,7-dimethoxy-1-methyl-4-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-2-yl]butyl]-C-methylcarbonimidoyl]azanide.
| Compound Name | [N-[4-[6,7-dimethoxy-1-methyl-4-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-2-yl]butyl]-C-methylcarbonimidoyl]azanide |
|---|---|
| PubChem CID | 72720504 |
| Molecular Formula | C26H31N5O2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | [N-[4-[6,7-dimethoxy-1-methyl-4-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-2-yl]butyl]-C-methylcarbonimidoyl]azanide |
| SMILES | COc1cc2c(/C=C3/Sc4ccccc4N3C)nc(CCCC/N=C(\C)[NH-])[n+](C)c2cc1OC |
| InChI | InChI=1S/C26H31N5O2S/c1-17(27)28-13-9-8-12-25-29-19(15-26-31(3)20-10-6-7-11-24(20)34-26)18-14-22(32-4)23(33-5)16-21(18)30(25)2/h6-7,10-11,14-16H,8-9,12-13H2,1-5H3,(H-,27,28) |
| InChIKey | BVNMFWPJBPYXGZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 74.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|