C26H32F6N4O4S — CID 171634606
4-[1,6-dimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyrimidin-1-ium-2-yl]butyl-trimethylazanium;bis(2,2,2-trifluoroacetate) (PubChem CID 171634606) has the molecular formula C26H32F6N4O4S and a molecular weight of 610.62 g/mol. Its IUPAC name is 4-[1,6-dimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyrimidin-1-ium-2-yl]butyl-trimethylazanium;bis(2,2,2-trifluoroacetate).
| Compound Name | 4-[1,6-dimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyrimidin-1-ium-2-yl]butyl-trimethylazanium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 171634606 |
| Molecular Formula | C26H32F6N4O4S |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | 4-[1,6-dimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyrimidin-1-ium-2-yl]butyl-trimethylazanium;bis(2,2,2-trifluoroacetate) |
| SMILES | Cc1cc(/C=C2\Sc3ccccc3N2C)nc(CCCC[N+](C)(C)C)[n+]1C.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C22H32N4S.2C2HF3O2/c1-17-15-18(16-22-25(3)19-11-7-8-12-20(19)27-22)23-21(24(17)2)13-9-10-14-26(4,5)6;2*3-2(4,5)1(6)7/h7-8,11-12,15-16H,9-10,13-14H2,1-6H3;2*(H,6,7)/q+2;;/p-2 |
| InChIKey | XCEXRUPKQUUOEW-UHFFFAOYSA-L |
| XLogP | 2.38 |
| TPSA | 100.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|