C29H47N6OS+3 — CID 171634627
4-[1,6-dimethyl-4-[(E)-[3-methyl-6-[4-(trimethylazaniumyl)butanoylamino]-1,3-benzothiazol-2-ylidene]methyl]pyrimidin-1-ium-2-yl]butyl-trimethylazanium (PubChem CID 171634627) has the molecular formula C29H47N6OS+3 and a molecular weight of 527.80 g/mol. Its IUPAC name is 4-[1,6-dimethyl-4-[(E)-[3-methyl-6-[4-(trimethylazaniumyl)butanoylamino]-1,3-benzothiazol-2-ylidene]methyl]pyrimidin-1-ium-2-yl]butyl-trimethylazanium.
| Compound Name | 4-[1,6-dimethyl-4-[(E)-[3-methyl-6-[4-(trimethylazaniumyl)butanoylamino]-1,3-benzothiazol-2-ylidene]methyl]pyrimidin-1-ium-2-yl]butyl-trimethylazanium |
|---|---|
| PubChem CID | 171634627 |
| Molecular Formula | C29H47N6OS+3 |
| Molecular Weight | 527.80 g/mol |
| Exact Mass | 527.35 |
| IUPAC Name | 4-[1,6-dimethyl-4-[(E)-[3-methyl-6-[4-(trimethylazaniumyl)butanoylamino]-1,3-benzothiazol-2-ylidene]methyl]pyrimidin-1-ium-2-yl]butyl-trimethylazanium |
| SMILES | Cc1cc(/C=C2/Sc3cc(NC(=O)CCC[N+](C)(C)C)ccc3N2C)nc(CCCC[N+](C)(C)C)[n+]1C |
| InChI | InChI=1S/C29H46N6OS/c1-22-19-24(30-27(32(22)2)13-10-11-17-34(4,5)6)21-29-33(3)25-16-15-23(20-26(25)37-29)31-28(36)14-12-18-35(7,8)9/h15-16,19-21H,10-14,17-18H2,1-9H3/q+2/p+1 |
| InChIKey | LGOZGSVDUWDFAS-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.80 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|