C38H38N5O2S+ — CID 101129973
N-[4-[6-[2,6-dimethyl-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]hexanoylamino]phenyl]quinoline-2-carboxamide (PubChem CID 101129973) has the molecular formula C38H38N5O2S+ and a molecular weight of 628.82 g/mol. Its IUPAC name is N-[4-[6-[2,6-dimethyl-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]hexanoylamino]phenyl]quinoline-2-carboxamide.
| Compound Name | N-[4-[6-[2,6-dimethyl-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]hexanoylamino]phenyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 101129973 |
| Molecular Formula | C38H38N5O2S+ |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | N-[4-[6-[2,6-dimethyl-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]hexanoylamino]phenyl]quinoline-2-carboxamide |
| SMILES | Cc1cc(C=C2Sc3ccccc3N2C)cc(C)[n+]1CCCCCC(=O)Nc1ccc(NC(=O)c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C38H37N5O2S/c1-26-23-28(25-37-42(3)34-13-8-9-14-35(34)46-37)24-27(2)43(26)22-10-4-5-15-36(44)39-30-17-19-31(20-18-30)40-38(45)33-21-16-29-11-6-7-12-32(29)41-33/h6-9,11-14,16-21,23-25H,4-5,10,15,22H2,1-3H3,(H-,39,40,41,44,45)/p+1 |
| InChIKey | CCXDKIBCICVZRU-UHFFFAOYSA-O |
| XLogP | 8.13 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|