C40H41N4O3S+ — CID 101129968
6-[2,6-dimethyl-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]-N-[4-[(2-naphthalen-2-yloxyacetyl)amino]phenyl]hexanamide (PubChem CID 101129968) has the molecular formula C40H41N4O3S+ and a molecular weight of 657.86 g/mol. Its IUPAC name is 6-[2,6-dimethyl-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]-N-[4-[(2-naphthalen-2-yloxyacetyl)amino]phenyl]hexanamide.
| Compound Name | 6-[2,6-dimethyl-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]-N-[4-[(2-naphthalen-2-yloxyacetyl)amino]phenyl]hexanamide |
|---|---|
| PubChem CID | 101129968 |
| Molecular Formula | C40H41N4O3S+ |
| Molecular Weight | 657.86 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | 6-[2,6-dimethyl-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]-N-[4-[(2-naphthalen-2-yloxyacetyl)amino]phenyl]hexanamide |
| SMILES | Cc1cc(C=C2Sc3ccccc3N2C)cc(C)[n+]1CCCCCC(=O)Nc1ccc(NC(=O)COc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C40H40N4O3S/c1-28-23-30(25-40-43(3)36-13-8-9-14-37(36)48-40)24-29(2)44(28)22-10-4-5-15-38(45)41-33-17-19-34(20-18-33)42-39(46)27-47-35-21-16-31-11-6-7-12-32(31)26-35/h6-9,11-14,16-21,23-26H,4-5,10,15,22,27H2,1-3H3,(H-,41,42,45,46)/p+1 |
| InChIKey | NKYWHIKMQAGPEJ-UHFFFAOYSA-O |
| XLogP | 8.50 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.86 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|