C21H25N2OS+ — CID 2333283
2-[[2,6-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole (PubChem CID 2333283) has the molecular formula C21H25N2OS+ and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-[[2,6-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole.
| Compound Name | 2-[[2,6-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 2333283 |
| Molecular Formula | C21H25N2OS+ |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-[[2,6-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole |
| SMILES | Cc1cc(C=C2Sc3ccccc3N2C)cc(C)[n+]1C[C@H]1CCCO1 |
| InChI | InChI=1S/C21H25N2OS/c1-15-11-17(12-16(2)23(15)14-18-7-6-10-24-18)13-21-22(3)19-8-4-5-9-20(19)25-21/h4-5,8-9,11-13,18H,6-7,10,14H2,1-3H3/q+1/t18-/m1/s1 |
| InChIKey | ZVMSOAPMDAUXKZ-GOSISDBHSA-N |
| XLogP | 4.31 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|