C20H23N2O2S2+ — CID 3579107
3-[2,6-dimethyl-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]thiolane 1,1-dioxide (PubChem CID 3579107) has the molecular formula C20H23N2O2S2+ and a molecular weight of 387.55 g/mol. Its IUPAC name is 3-[2,6-dimethyl-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[2,6-dimethyl-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 3579107 |
| Molecular Formula | C20H23N2O2S2+ |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3-[2,6-dimethyl-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]thiolane 1,1-dioxide |
| SMILES | Cc1cc(C=C2Sc3ccccc3N2C)cc(C)[n+]1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H23N2O2S2/c1-14-10-16(11-15(2)22(14)17-8-9-26(23,24)13-17)12-20-21(3)18-6-4-5-7-19(18)25-20/h4-7,10-12,17H,8-9,13H2,1-3H3/q+1 |
| InChIKey | OTBNHLYVOMUJFL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|