C27H24NO2S+ — CID 2323744
(3R)-3-(2,4,6-triphenylpyridin-1-ium-1-yl)thiolane 1,1-dioxide (PubChem CID 2323744) has the molecular formula C27H24NO2S+ and a molecular weight of 426.56 g/mol. Its IUPAC name is (3R)-3-(2,4,6-triphenylpyridin-1-ium-1-yl)thiolane 1,1-dioxide.
| Compound Name | (3R)-3-(2,4,6-triphenylpyridin-1-ium-1-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 2323744 |
| Molecular Formula | C27H24NO2S+ |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (3R)-3-(2,4,6-triphenylpyridin-1-ium-1-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@@H]([n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)C1 |
| InChI | InChI=1S/C27H24NO2S/c29-31(30)17-16-25(20-31)28-26(22-12-6-2-7-13-22)18-24(21-10-4-1-5-11-21)19-27(28)23-14-8-3-9-15-23/h1-15,18-19,25H,16-17,20H2/q+1/t25-/m1/s1 |
| InChIKey | OBFSIBQTTJEMEJ-RUZDIDTESA-N |
| XLogP | 5.33 |
| TPSA | 38.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|